C31H52OS2 — CID 170108943
5-[[(10R)-10,13-dimethyl-17-(5-methylhexyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]disulfanyl]pentanal (PubChem CID 170108943) has the molecular formula C31H52OS2 and a molecular weight of 504.89 g/mol. Its IUPAC name is 5-[[(10R)-10,13-dimethyl-17-(5-methylhexyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]disulfanyl]pentanal.
| Compound Name | 5-[[(10R)-10,13-dimethyl-17-(5-methylhexyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]disulfanyl]pentanal |
|---|---|
| PubChem CID | 170108943 |
| Molecular Formula | C31H52OS2 |
| Molecular Weight | 504.89 g/mol |
| Exact Mass | 504.35 |
| IUPAC Name | 5-[[(10R)-10,13-dimethyl-17-(5-methylhexyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]disulfanyl]pentanal |
| SMILES | CC(C)CCCCC1CCC2C3CC=C4CC(SSCCCCC=O)CC[C@]4(C)C3CCC12C |
| InChI | InChI=1S/C31H52OS2/c1-23(2)10-6-7-11-24-13-15-28-27-14-12-25-22-26(34-33-21-9-5-8-20-32)16-18-31(25,4)29(27)17-19-30(24,28)3/h12,20,23-24,26-29H,5-11,13-19,21-22H2,1-4H3/t24?,26?,27?,28?,29?,30?,31-/m0/s1 |
| InChIKey | VCTUHMFLHCOFLQ-HFFIGKOLSA-N |
| XLogP | 9.90 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.89 |
| LogP ≤ 5 | 9.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|