C36H63NOS2 — CID 153362462
3-[[10,13-dimethyl-17-(5-methylhexyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]disulfanyl]-N-heptylpropanamide (PubChem CID 153362462) has the molecular formula C36H63NOS2 and a molecular weight of 590.04 g/mol. Its IUPAC name is 3-[[10,13-dimethyl-17-(5-methylhexyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]disulfanyl]-N-heptylpropanamide.
| Compound Name | 3-[[10,13-dimethyl-17-(5-methylhexyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]disulfanyl]-N-heptylpropanamide |
|---|---|
| PubChem CID | 153362462 |
| Molecular Formula | C36H63NOS2 |
| Molecular Weight | 590.04 g/mol |
| Exact Mass | 589.44 |
| IUPAC Name | 3-[[10,13-dimethyl-17-(5-methylhexyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]disulfanyl]-N-heptylpropanamide |
| SMILES | CCCCCCCNC(=O)CCSSC1CCC2(C)C(=CCC3C2CCC2(C)C(CCCCC(C)C)CCC32)C1 |
| InChI | InChI=1S/C36H63NOS2/c1-6-7-8-9-12-24-37-34(38)21-25-39-40-30-19-22-36(5)29(26-30)15-17-31-32-18-16-28(14-11-10-13-27(2)3)35(32,4)23-20-33(31)36/h15,27-28,30-33H,6-14,16-26H2,1-5H3,(H,37,38) |
| InChIKey | SCOPPCGDHDORET-UHFFFAOYSA-N |
| XLogP | 11.01 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.04 |
| LogP ≤ 5 | 11.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|