C40H76N4OS2 — CID 167446618
N,N'-bis(3-aminopropyl)-N'-methylbutane-1,4-diamine;3-[[10,13-dimethyl-17-(5-methylhexyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]disulfanyl]propanal (PubChem CID 167446618) has the molecular formula C40H76N4OS2 and a molecular weight of 693.21 g/mol. Its IUPAC name is N,N'-bis(3-aminopropyl)-N'-methylbutane-1,4-diamine;3-[[10,13-dimethyl-17-(5-methylhexyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]disulfanyl]propanal.
| Compound Name | N,N'-bis(3-aminopropyl)-N'-methylbutane-1,4-diamine;3-[[10,13-dimethyl-17-(5-methylhexyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]disulfanyl]propanal |
|---|---|
| PubChem CID | 167446618 |
| Molecular Formula | C40H76N4OS2 |
| Molecular Weight | 693.21 g/mol |
| Exact Mass | 692.55 |
| IUPAC Name | N,N'-bis(3-aminopropyl)-N'-methylbutane-1,4-diamine;3-[[10,13-dimethyl-17-(5-methylhexyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]disulfanyl]propanal |
| SMILES | CC(C)CCCCC1CCC2C3CC=C4CC(SSCCC=O)CCC4(C)C3CCC12C.CN(CCCN)CCCCNCCCN |
| InChI | InChI=1S/C29H48OS2.C11H28N4/c1-21(2)8-5-6-9-22-11-13-26-25-12-10-23-20-24(32-31-19-7-18-30)14-16-29(23,4)27(25)15-17-28(22,26)3;1-15(11-5-7-13)10-3-2-8-14-9-4-6-12/h10,18,21-22,24-27H,5-9,11-17,19-20H2,1-4H3;14H,2-13H2,1H3 |
| InChIKey | GTLLGZFNWKNENX-UHFFFAOYSA-N |
| XLogP | 9.11 |
| TPSA | 84.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.21 |
| LogP ≤ 5 | 9.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|