C32H57NS2 — CID 164776928
3-[[(8S,9S,10R,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]disulfanyl]-N,N-dimethylpropan-1-amine (PubChem CID 164776928) has the molecular formula C32H57NS2 and a molecular weight of 519.95 g/mol. Its IUPAC name is 3-[[(8S,9S,10R,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]disulfanyl]-N,N-dimethylpropan-1-amine.
| Compound Name | 3-[[(8S,9S,10R,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]disulfanyl]-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 164776928 |
| Molecular Formula | C32H57NS2 |
| Molecular Weight | 519.95 g/mol |
| Exact Mass | 519.39 |
| IUPAC Name | 3-[[(8S,9S,10R,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]disulfanyl]-N,N-dimethylpropan-1-amine |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CCC2[C@@H]3CC=C4CC(SSCCCN(C)C)CC[C@]4(C)[C@H]3CC[C@@]21C |
| InChI | InChI=1S/C32H57NS2/c1-23(2)10-8-11-24(3)28-14-15-29-27-13-12-25-22-26(35-34-21-9-20-33(6)7)16-18-31(25,4)30(27)17-19-32(28,29)5/h12,23-24,26-30H,8-11,13-22H2,1-7H3/t24-,26?,27+,28-,29?,30+,31+,32-/m1/s1 |
| InChIKey | AFLRFWCOLYVAGL-ONRZZFOZSA-N |
| XLogP | 9.73 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.95 |
| LogP ≤ 5 | 9.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|