C33H58S2 — CID 170106632
3-(2,2-dimethylbutyldisulfanyl)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene (PubChem CID 170106632) has the molecular formula C33H58S2 and a molecular weight of 518.96 g/mol. Its IUPAC name is 3-(2,2-dimethylbutyldisulfanyl)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene.
| Compound Name | 3-(2,2-dimethylbutyldisulfanyl)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 170106632 |
| Molecular Formula | C33H58S2 |
| Molecular Weight | 518.96 g/mol |
| Exact Mass | 518.40 |
| IUPAC Name | 3-(2,2-dimethylbutyldisulfanyl)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene |
| SMILES | CCC(C)(C)CSSC1CCC2(C)C(=CCC3C2CCC2(C)C3CCC2[C@H](C)CCCC(C)C)C1 |
| InChI | InChI=1S/C33H58S2/c1-9-31(5,6)22-34-35-26-17-19-32(7)25(21-26)13-14-27-29-16-15-28(24(4)12-10-11-23(2)3)33(29,8)20-18-30(27)32/h13,23-24,26-30H,9-12,14-22H2,1-8H3/t24-,26?,27?,28?,29?,30?,32?,33?/m1/s1 |
| InChIKey | ZFGSUSYGWKZBAP-PSHBRHROSA-N |
| XLogP | 11.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.96 |
| LogP ≤ 5 | 11.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|