C24H38O — CID 118133598
(3R)-3-[(3S,10R,13R,17R)-3,10,13-trimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]butanal (PubChem CID 118133598) has the molecular formula C24H38O and a molecular weight of 342.57 g/mol. Its IUPAC name is (3R)-3-[(3S,10R,13R,17R)-3,10,13-trimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]butanal.
| Compound Name | (3R)-3-[(3S,10R,13R,17R)-3,10,13-trimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]butanal |
|---|---|
| PubChem CID | 118133598 |
| Molecular Formula | C24H38O |
| Molecular Weight | 342.57 g/mol |
| Exact Mass | 342.29 |
| IUPAC Name | (3R)-3-[(3S,10R,13R,17R)-3,10,13-trimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]butanal |
| SMILES | C[C@H]1CC[C@@]2(C)C(=CCC3C2CC[C@@]2(C)C3CC[C@@H]2[C@H](C)CC=O)C1 |
| InChI | InChI=1S/C24H38O/c1-16-9-12-23(3)18(15-16)5-6-19-21-8-7-20(17(2)11-14-25)24(21,4)13-10-22(19)23/h5,14,16-17,19-22H,6-13,15H2,1-4H3/t16-,17+,19?,20+,21?,22?,23-,24+/m0/s1 |
| InChIKey | BCSQCZKBGSBNDU-YVQHCYQGSA-N |
| XLogP | 6.43 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.57 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|