C31H46 — CID 169079641
(3S,8S,9S,10R,13R,14S,17R)-3,10,13-trimethyl-17-[(2R)-4-(2-methylphenyl)butan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene (PubChem CID 169079641) has the molecular formula C31H46 and a molecular weight of 418.71 g/mol. Its IUPAC name is (3S,8S,9S,10R,13R,14S,17R)-3,10,13-trimethyl-17-[(2R)-4-(2-methylphenyl)butan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene.
| Compound Name | (3S,8S,9S,10R,13R,14S,17R)-3,10,13-trimethyl-17-[(2R)-4-(2-methylphenyl)butan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 169079641 |
| Molecular Formula | C31H46 |
| Molecular Weight | 418.71 g/mol |
| Exact Mass | 418.36 |
| IUPAC Name | (3S,8S,9S,10R,13R,14S,17R)-3,10,13-trimethyl-17-[(2R)-4-(2-methylphenyl)butan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene |
| SMILES | Cc1ccccc1CC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@@H](C)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C31H46/c1-21-16-18-30(4)25(20-21)12-13-26-28-15-14-27(31(28,5)19-17-29(26)30)23(3)10-11-24-9-7-6-8-22(24)2/h6-9,12,21,23,26-29H,10-11,13-20H2,1-5H3/t21-,23+,26-,27+,28-,29-,30-,31+/m0/s1 |
| InChIKey | DDNYHZBOIPHWLN-XQNDRCPMSA-N |
| XLogP | 8.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.71 |
| LogP ≤ 5 | 8.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|