C32H61N — CID 145486660
N,N-dimethylethanamine;2-methylbutane;3,10,13-trimethyl-17-propan-2-yl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene (PubChem CID 145486660) has the molecular formula C32H61N and a molecular weight of 459.85 g/mol. Its IUPAC name is N,N-dimethylethanamine;2-methylbutane;3,10,13-trimethyl-17-propan-2-yl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene.
| Compound Name | N,N-dimethylethanamine;2-methylbutane;3,10,13-trimethyl-17-propan-2-yl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 145486660 |
| Molecular Formula | C32H61N |
| Molecular Weight | 459.85 g/mol |
| Exact Mass | 459.48 |
| IUPAC Name | N,N-dimethylethanamine;2-methylbutane;3,10,13-trimethyl-17-propan-2-yl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene |
| SMILES | CC1CCC2(C)C(=CCC3C2CCC2(C)C(C(C)C)CCC32)C1.CCC(C)C.CCN(C)C |
| InChI | InChI=1S/C23H38.C5H12.C4H11N/c1-15(2)19-8-9-20-18-7-6-17-14-16(3)10-12-22(17,4)21(18)11-13-23(19,20)5;2*1-4-5(2)3/h6,15-16,18-21H,7-14H2,1-5H3;5H,4H2,1-3H3;4H2,1-3H3 |
| InChIKey | WTRFADWIZFLTAB-UHFFFAOYSA-N |
| XLogP | 9.48 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.85 |
| LogP ≤ 5 | 9.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|