C26H44O3S — CID 129286840
[(4R)-4-[(3S,8S,9S,10R,13R,14S,17R)-3,10,13-trimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentyl] methanesulfonate (PubChem CID 129286840) has the molecular formula C26H44O3S and a molecular weight of 436.70 g/mol. Its IUPAC name is [(4R)-4-[(3S,8S,9S,10R,13R,14S,17R)-3,10,13-trimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentyl] methanesulfonate.
| Compound Name | [(4R)-4-[(3S,8S,9S,10R,13R,14S,17R)-3,10,13-trimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentyl] methanesulfonate |
|---|---|
| PubChem CID | 129286840 |
| Molecular Formula | C26H44O3S |
| Molecular Weight | 436.70 g/mol |
| Exact Mass | 436.30 |
| IUPAC Name | [(4R)-4-[(3S,8S,9S,10R,13R,14S,17R)-3,10,13-trimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentyl] methanesulfonate |
| SMILES | C[C@H]1CC[C@@]2(C)C(=CC[C@H]3[C@@H]4CC[C@H]([C@H](C)CCCOS(C)(=O)=O)[C@@]4(C)CC[C@@H]32)C1 |
| InChI | InChI=1S/C26H44O3S/c1-18-12-14-25(3)20(17-18)8-9-21-23-11-10-22(26(23,4)15-13-24(21)25)19(2)7-6-16-29-30(5,27)28/h8,18-19,21-24H,6-7,9-17H2,1-5H3/t18-,19+,21-,22+,23-,24-,25-,26+/m0/s1 |
| InChIKey | YRMSZDRLIDZOPM-CGHWZSTFSA-N |
| XLogP | 6.59 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.70 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|