C22H30O3 — CID 123846251
(8S,9S,10R,13R,14S,17S)-17-ethyl-10,13-dimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-1-carboxylic acid (PubChem CID 123846251) has the molecular formula C22H30O3 and a molecular weight of 342.48 g/mol. Its IUPAC name is (8S,9S,10R,13R,14S,17S)-17-ethyl-10,13-dimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-1-carboxylic acid.
| Compound Name | (8S,9S,10R,13R,14S,17S)-17-ethyl-10,13-dimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-1-carboxylic acid |
|---|---|
| PubChem CID | 123846251 |
| Molecular Formula | C22H30O3 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.22 |
| IUPAC Name | (8S,9S,10R,13R,14S,17S)-17-ethyl-10,13-dimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-1-carboxylic acid |
| SMILES | CC[C@H]1CC[C@H]2[C@@H]3CCC4=CC(=O)C=C(C(=O)O)[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C22H30O3/c1-4-13-6-8-17-16-7-5-14-11-15(23)12-19(20(24)25)22(14,3)18(16)9-10-21(13,17)2/h11-13,16-18H,4-10H2,1-3H3,(H,24,25)/t13-,16-,17-,18-,21+,22-/m0/s1 |
| InChIKey | IGYUMCRJCKRUPM-DSRVKQEOSA-N |
| XLogP | 4.78 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |