C23H34O4 — CID 70088137
(8S,9S,10S,13R,14S,17S)-17-ethyl-10,13-dimethyl-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-1,2-dicarboxylic acid (PubChem CID 70088137) has the molecular formula C23H34O4 and a molecular weight of 374.52 g/mol. Its IUPAC name is (8S,9S,10S,13R,14S,17S)-17-ethyl-10,13-dimethyl-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-1,2-dicarboxylic acid.
| Compound Name | (8S,9S,10S,13R,14S,17S)-17-ethyl-10,13-dimethyl-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-1,2-dicarboxylic acid |
|---|---|
| PubChem CID | 70088137 |
| Molecular Formula | C23H34O4 |
| Molecular Weight | 374.52 g/mol |
| Exact Mass | 374.25 |
| IUPAC Name | (8S,9S,10S,13R,14S,17S)-17-ethyl-10,13-dimethyl-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-1,2-dicarboxylic acid |
| SMILES | CC[C@H]1CC[C@H]2[C@@H]3CCC4=CCC(C(=O)O)C(C(=O)O)[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C23H34O4/c1-4-13-7-10-17-15-8-5-14-6-9-16(20(24)25)19(21(26)27)23(14,3)18(15)11-12-22(13,17)2/h6,13,15-19H,4-5,7-12H2,1-3H3,(H,24,25)(H,26,27)/t13-,15-,16?,17-,18-,19?,22+,23-/m0/s1 |
| InChIKey | POLGOYGYJFSDEX-NCMDABPZSA-N |
| XLogP | 4.99 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.52 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|