C22H34 — CID 18608023
(8S,9S,10R,13R,14S,17S)-17-ethyl-10,13-dimethyl-2-methylidene-1,3,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene (PubChem CID 18608023) has the molecular formula C22H34 and a molecular weight of 298.51 g/mol. Its IUPAC name is (8S,9S,10R,13R,14S,17S)-17-ethyl-10,13-dimethyl-2-methylidene-1,3,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene.
| Compound Name | (8S,9S,10R,13R,14S,17S)-17-ethyl-10,13-dimethyl-2-methylidene-1,3,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 18608023 |
| Molecular Formula | C22H34 |
| Molecular Weight | 298.51 g/mol |
| Exact Mass | 298.27 |
| IUPAC Name | (8S,9S,10R,13R,14S,17S)-17-ethyl-10,13-dimethyl-2-methylidene-1,3,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene |
| SMILES | C=C1CC=C2CC[C@H]3[C@@H]4CC[C@H](CC)[C@@]4(C)CC[C@@H]3[C@@]2(C)C1 |
| InChI | InChI=1S/C22H34/c1-5-16-9-11-19-18-10-8-17-7-6-15(2)14-22(17,4)20(18)12-13-21(16,19)3/h7,16,18-20H,2,5-6,8-14H2,1,3-4H3/t16-,18-,19-,20-,21+,22-/m0/s1 |
| InChIKey | XTUAWUNFNDRTLT-VRDFRSIPSA-N |
| XLogP | 6.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.51 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|