C22H37P — CID 144867285
[3-ethyl-3a-methyl-6-(3-methylbut-3-enyl)-7-methylidene-1,2,3,4,5,5a,8,9,9a,9b-decahydrocyclopenta[a]naphthalen-6-yl]phosphane (PubChem CID 144867285) has the molecular formula C22H37P and a molecular weight of 332.51 g/mol. Its IUPAC name is [3-ethyl-3a-methyl-6-(3-methylbut-3-enyl)-7-methylidene-1,2,3,4,5,5a,8,9,9a,9b-decahydrocyclopenta[a]naphthalen-6-yl]phosphane.
| Compound Name | [3-ethyl-3a-methyl-6-(3-methylbut-3-enyl)-7-methylidene-1,2,3,4,5,5a,8,9,9a,9b-decahydrocyclopenta[a]naphthalen-6-yl]phosphane |
|---|---|
| PubChem CID | 144867285 |
| Molecular Formula | C22H37P |
| Molecular Weight | 332.51 g/mol |
| Exact Mass | 332.26 |
| IUPAC Name | [3-ethyl-3a-methyl-6-(3-methylbut-3-enyl)-7-methylidene-1,2,3,4,5,5a,8,9,9a,9b-decahydrocyclopenta[a]naphthalen-6-yl]phosphane |
| SMILES | C=C(C)CCC1(P)C(=C)CCC2C1CCC1(C)C(CC)CCC21 |
| InChI | InChI=1S/C22H37P/c1-6-17-8-10-19-18-9-7-16(4)22(23,14-11-15(2)3)20(18)12-13-21(17,19)5/h17-20H,2,4,6-14,23H2,1,3,5H3 |
| InChIKey | OCRDVMNAHKAMNL-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.51 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|