C21H34O2 — CID 66920684
(8S,9S,10R,13R,14S,17S)-17-ethyl-5-hydroxy-10,13-dimethyl-3,4,6,7,8,9,11,12,14,15,16,17-dodecahydro-2H-cyclopenta[a]phenanthren-1-one (PubChem CID 66920684) has the molecular formula C21H34O2 and a molecular weight of 318.50 g/mol. Its IUPAC name is (8S,9S,10R,13R,14S,17S)-17-ethyl-5-hydroxy-10,13-dimethyl-3,4,6,7,8,9,11,12,14,15,16,17-dodecahydro-2H-cyclopenta[a]phenanthren-1-one.
| Compound Name | (8S,9S,10R,13R,14S,17S)-17-ethyl-5-hydroxy-10,13-dimethyl-3,4,6,7,8,9,11,12,14,15,16,17-dodecahydro-2H-cyclopenta[a]phenanthren-1-one |
|---|---|
| PubChem CID | 66920684 |
| Molecular Formula | C21H34O2 |
| Molecular Weight | 318.50 g/mol |
| Exact Mass | 318.26 |
| IUPAC Name | (8S,9S,10R,13R,14S,17S)-17-ethyl-5-hydroxy-10,13-dimethyl-3,4,6,7,8,9,11,12,14,15,16,17-dodecahydro-2H-cyclopenta[a]phenanthren-1-one |
| SMILES | CC[C@H]1CC[C@H]2[C@@H]3CCC4(O)CCCC(=O)[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C21H34O2/c1-4-14-7-8-16-15-9-13-21(23)11-5-6-18(22)20(21,3)17(15)10-12-19(14,16)2/h14-17,23H,4-13H2,1-3H3/t14-,15-,16-,17-,19+,20-,21?/m0/s1 |
| InChIKey | ZGIMARHCHTWLHT-IHMBBAMMSA-N |
| XLogP | 4.74 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.50 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |