C23H34 — CID 173405008
(1S,2R,11S,12S,15S,16R)-15-ethyl-2,16-dimethyl-9-methylidenepentacyclo[9.7.0.02,8.03,5.012,16]octadec-3(5)-ene (PubChem CID 173405008) has the molecular formula C23H34 and a molecular weight of 310.53 g/mol. Its IUPAC name is (1S,2R,11S,12S,15S,16R)-15-ethyl-2,16-dimethyl-9-methylidenepentacyclo[9.7.0.02,8.03,5.012,16]octadec-3(5)-ene.
| Compound Name | (1S,2R,11S,12S,15S,16R)-15-ethyl-2,16-dimethyl-9-methylidenepentacyclo[9.7.0.02,8.03,5.012,16]octadec-3(5)-ene |
|---|---|
| PubChem CID | 173405008 |
| Molecular Formula | C23H34 |
| Molecular Weight | 310.53 g/mol |
| Exact Mass | 310.27 |
| IUPAC Name | (1S,2R,11S,12S,15S,16R)-15-ethyl-2,16-dimethyl-9-methylidenepentacyclo[9.7.0.02,8.03,5.012,16]octadec-3(5)-ene |
| SMILES | C=C1C[C@H]2[C@@H]3CC[C@H](CC)[C@@]3(C)CC[C@@H]2[C@@]2(C)C3=C(CCC12)C3 |
| InChI | InChI=1S/C23H34/c1-5-16-7-9-19-17-12-14(2)18-8-6-15-13-21(15)23(18,4)20(17)10-11-22(16,19)3/h16-20H,2,5-13H2,1,3-4H3/t16-,17-,18?,19-,20-,22+,23-/m0/s1 |
| InChIKey | HNZWSJHIRXBAMB-DWRCGWMVSA-N |
| XLogP | 6.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.53 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|