C20H24F2O3 — CID 67730329
(8S,9S,10R,13S,14S,17S)-1,2-difluoro-10,13-dimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-17-carboxylic acid (PubChem CID 67730329) has the molecular formula C20H24F2O3 and a molecular weight of 350.41 g/mol. Its IUPAC name is (8S,9S,10R,13S,14S,17S)-1,2-difluoro-10,13-dimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-17-carboxylic acid.
| Compound Name | (8S,9S,10R,13S,14S,17S)-1,2-difluoro-10,13-dimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-17-carboxylic acid |
|---|---|
| PubChem CID | 67730329 |
| Molecular Formula | C20H24F2O3 |
| Molecular Weight | 350.41 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | (8S,9S,10R,13S,14S,17S)-1,2-difluoro-10,13-dimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-17-carboxylic acid |
| SMILES | C[C@@]12C(=CC(=O)C(F)=C1F)CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](C(=O)O)CC[C@@H]12 |
| InChI | InChI=1S/C20H24F2O3/c1-19-8-7-13-11(12(19)5-6-14(19)18(24)25)4-3-10-9-15(23)16(21)17(22)20(10,13)2/h9,11-14H,3-8H2,1-2H3,(H,24,25)/t11-,12-,13-,14+,19-,20-/m0/s1 |
| InChIKey | CVHPTZFHXWUNJV-OJFCGGSYSA-N |
| XLogP | 4.59 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.41 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|