C21H28O2S — CID 91583489
(8S,9S,10S,13S,14S)-2,10,13-trimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-17-carbothioic S-acid (PubChem CID 91583489) has the molecular formula C21H28O2S and a molecular weight of 344.52 g/mol. Its IUPAC name is (8S,9S,10S,13S,14S)-2,10,13-trimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-17-carbothioic S-acid.
| Compound Name | (8S,9S,10S,13S,14S)-2,10,13-trimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-17-carbothioic S-acid |
|---|---|
| PubChem CID | 91583489 |
| Molecular Formula | C21H28O2S |
| Molecular Weight | 344.52 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | (8S,9S,10S,13S,14S)-2,10,13-trimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-17-carbothioic S-acid |
| SMILES | CC1=C[C@@]2(C)C(=CC1=O)CC[C@@H]1[C@@H]2CC[C@]2(C)C(C(=O)S)CC[C@@H]12 |
| InChI | InChI=1S/C21H28O2S/c1-12-11-21(3)13(10-18(12)22)4-5-14-15-6-7-17(19(23)24)20(15,2)9-8-16(14)21/h10-11,14-17H,4-9H2,1-3H3,(H,23,24)/t14-,15-,16-,17?,20-,21-/m0/s1 |
| InChIKey | JAUKMKANZFHLGG-HYGUSNFJSA-N |
| XLogP | 4.76 |
| TPSA | 34.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.52 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|