C23H30O4S — CID 88745213
(1S,2R,13S,14S,17R,18S)-2,5,5,18-tetramethyl-8-oxo-4,6-dioxapentacyclo[11.7.0.02,10.03,7.014,18]icosa-3(7),9-diene-17-carbothioic S-acid (PubChem CID 88745213) has the molecular formula C23H30O4S and a molecular weight of 402.56 g/mol. Its IUPAC name is (1S,2R,13S,14S,17R,18S)-2,5,5,18-tetramethyl-8-oxo-4,6-dioxapentacyclo[11.7.0.02,10.03,7.014,18]icosa-3(7),9-diene-17-carbothioic S-acid.
| Compound Name | (1S,2R,13S,14S,17R,18S)-2,5,5,18-tetramethyl-8-oxo-4,6-dioxapentacyclo[11.7.0.02,10.03,7.014,18]icosa-3(7),9-diene-17-carbothioic S-acid |
|---|---|
| PubChem CID | 88745213 |
| Molecular Formula | C23H30O4S |
| Molecular Weight | 402.56 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | (1S,2R,13S,14S,17R,18S)-2,5,5,18-tetramethyl-8-oxo-4,6-dioxapentacyclo[11.7.0.02,10.03,7.014,18]icosa-3(7),9-diene-17-carbothioic S-acid |
| SMILES | CC1(C)OC2=C(O1)[C@@]1(C)C(=CC2=O)CC[C@@H]2[C@@H]1CC[C@]1(C)[C@H](C(=O)S)CC[C@@H]21 |
| InChI | InChI=1S/C23H30O4S/c1-21(2)26-18-17(24)11-12-5-6-13-14-7-8-16(20(25)28)22(14,3)10-9-15(13)23(12,4)19(18)27-21/h11,13-16H,5-10H2,1-4H3,(H,25,28)/t13-,14-,15-,16-,22-,23-/m0/s1 |
| InChIKey | NXBGBIYILSHHQU-XABOBLSZSA-N |
| XLogP | 4.81 |
| TPSA | 52.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.56 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|