C22H28O6 — CID 70467836
methyl 2-[(8S,9S,10R,13S,14S,17S)-2,3-dihydroxy-10,13-dimethyl-1-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]-2-oxoacetate (PubChem CID 70467836) has the molecular formula C22H28O6 and a molecular weight of 388.46 g/mol. Its IUPAC name is methyl 2-[(8S,9S,10R,13S,14S,17S)-2,3-dihydroxy-10,13-dimethyl-1-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]-2-oxoacetate.
| Compound Name | methyl 2-[(8S,9S,10R,13S,14S,17S)-2,3-dihydroxy-10,13-dimethyl-1-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]-2-oxoacetate |
|---|---|
| PubChem CID | 70467836 |
| Molecular Formula | C22H28O6 |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | methyl 2-[(8S,9S,10R,13S,14S,17S)-2,3-dihydroxy-10,13-dimethyl-1-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]-2-oxoacetate |
| SMILES | COC(=O)C(=O)[C@H]1CC[C@H]2[C@@H]3CCC4=CC(O)=C(O)C(=O)[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C22H28O6/c1-21-9-8-14-12(13(21)6-7-15(21)17(24)20(27)28-3)5-4-11-10-16(23)18(25)19(26)22(11,14)2/h10,12-15,23,25H,4-9H2,1-3H3/t12-,13-,14-,15+,21-,22-/m0/s1 |
| InChIKey | QIXMNQXOJUFNCZ-YBJPIPKVSA-N |
| XLogP | 3.42 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|