C28H34O4 — CID 70400969
(8S,9S,10R,13S,14S,16R,17S)-2,3-dihydroxy-10,13,16-trimethyl-17-(1-phenoxyethenyl)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-1-one (PubChem CID 70400969) has the molecular formula C28H34O4 and a molecular weight of 434.58 g/mol. Its IUPAC name is (8S,9S,10R,13S,14S,16R,17S)-2,3-dihydroxy-10,13,16-trimethyl-17-(1-phenoxyethenyl)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-1-one.
| Compound Name | (8S,9S,10R,13S,14S,16R,17S)-2,3-dihydroxy-10,13,16-trimethyl-17-(1-phenoxyethenyl)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-1-one |
|---|---|
| PubChem CID | 70400969 |
| Molecular Formula | C28H34O4 |
| Molecular Weight | 434.58 g/mol |
| Exact Mass | 434.25 |
| IUPAC Name | (8S,9S,10R,13S,14S,16R,17S)-2,3-dihydroxy-10,13,16-trimethyl-17-(1-phenoxyethenyl)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-1-one |
| SMILES | C=C(Oc1ccccc1)[C@H]1[C@H](C)C[C@H]2[C@@H]3CCC4=CC(O)=C(O)C(=O)[C@]4(C)[C@H]3CC[C@@]21C |
| InChI | InChI=1S/C28H34O4/c1-16-14-22-20-11-10-18-15-23(29)25(30)26(31)28(18,4)21(20)12-13-27(22,3)24(16)17(2)32-19-8-6-5-7-9-19/h5-9,15-16,20-22,24,29-30H,2,10-14H2,1,3-4H3/t16-,20-,21+,22+,24-,27+,28+/m1/s1 |
| InChIKey | DXRMGESJTQVVRQ-IZUXMBIGSA-N |
| XLogP | 6.52 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.58 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|