C28H41NO4 — CID 70558401
N-hexyl-2-[(8S,9S,10R,13S,14S,17S)-3-hydroxy-10,13,16-trimethyl-1-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]-2-oxoacetamide (PubChem CID 70558401) has the molecular formula C28H41NO4 and a molecular weight of 455.64 g/mol. Its IUPAC name is N-hexyl-2-[(8S,9S,10R,13S,14S,17S)-3-hydroxy-10,13,16-trimethyl-1-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]-2-oxoacetamide.
| Compound Name | N-hexyl-2-[(8S,9S,10R,13S,14S,17S)-3-hydroxy-10,13,16-trimethyl-1-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]-2-oxoacetamide |
|---|---|
| PubChem CID | 70558401 |
| Molecular Formula | C28H41NO4 |
| Molecular Weight | 455.64 g/mol |
| Exact Mass | 455.30 |
| IUPAC Name | N-hexyl-2-[(8S,9S,10R,13S,14S,17S)-3-hydroxy-10,13,16-trimethyl-1-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]-2-oxoacetamide |
| SMILES | CCCCCCNC(=O)C(=O)[C@H]1C(C)C[C@H]2[C@@H]3CCC4=CC(O)=CC(=O)[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C28H41NO4/c1-5-6-7-8-13-29-26(33)25(32)24-17(2)14-22-20-10-9-18-15-19(30)16-23(31)28(18,4)21(20)11-12-27(22,24)3/h15-17,20-22,24,30H,5-14H2,1-4H3,(H,29,33)/t17?,20-,21+,22+,24-,27+,28+/m1/s1 |
| InChIKey | JXFWURDGBBFCOO-KPOSFVHOSA-N |
| XLogP | 5.31 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.64 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|