C25H30O4 — CID 70557029
(8S,9S,10R,13S,14S,17S)-3,17-dihydroxy-17-(2-hydroxyphenyl)-10,13-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-1-one (PubChem CID 70557029) has the molecular formula C25H30O4 and a molecular weight of 394.51 g/mol. Its IUPAC name is (8S,9S,10R,13S,14S,17S)-3,17-dihydroxy-17-(2-hydroxyphenyl)-10,13-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-1-one.
| Compound Name | (8S,9S,10R,13S,14S,17S)-3,17-dihydroxy-17-(2-hydroxyphenyl)-10,13-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-1-one |
|---|---|
| PubChem CID | 70557029 |
| Molecular Formula | C25H30O4 |
| Molecular Weight | 394.51 g/mol |
| Exact Mass | 394.21 |
| IUPAC Name | (8S,9S,10R,13S,14S,17S)-3,17-dihydroxy-17-(2-hydroxyphenyl)-10,13-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-1-one |
| SMILES | C[C@]12C(=O)C=C(O)C=C1CC[C@@H]1[C@@H]2CC[C@@]2(C)[C@H]1CC[C@@]2(O)c1ccccc1O |
| InChI | InChI=1S/C25H30O4/c1-23-11-9-19-17(8-7-15-13-16(26)14-22(28)24(15,19)2)18(23)10-12-25(23,29)20-5-3-4-6-21(20)27/h3-6,13-14,17-19,26-27,29H,7-12H2,1-2H3/t17-,18-,19-,23-,24-,25+/m0/s1 |
| InChIKey | CZMUJXUSHYCXCN-XSHBKHDUSA-N |
| XLogP | 4.77 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.51 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |