C26H30O5 — CID 154100632
2-[(8S,9S,10S,13S,14S,17S)-10-formyl-17-hydroxy-13-methyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl]benzoic acid (PubChem CID 154100632) has the molecular formula C26H30O5 and a molecular weight of 422.52 g/mol. Its IUPAC name is 2-[(8S,9S,10S,13S,14S,17S)-10-formyl-17-hydroxy-13-methyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl]benzoic acid.
| Compound Name | 2-[(8S,9S,10S,13S,14S,17S)-10-formyl-17-hydroxy-13-methyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl]benzoic acid |
|---|---|
| PubChem CID | 154100632 |
| Molecular Formula | C26H30O5 |
| Molecular Weight | 422.52 g/mol |
| Exact Mass | 422.21 |
| IUPAC Name | 2-[(8S,9S,10S,13S,14S,17S)-10-formyl-17-hydroxy-13-methyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl]benzoic acid |
| SMILES | C[C@]12CC[C@H]3[C@@H](CCC4=CC(=O)CC[C@@]43C=O)[C@@H]1CC[C@@]2(O)c1ccccc1C(=O)O |
| InChI | InChI=1S/C26H30O5/c1-24-11-9-21-18(7-6-16-14-17(28)8-12-25(16,21)15-27)20(24)10-13-26(24,31)22-5-3-2-4-19(22)23(29)30/h2-5,14-15,18,20-21,31H,6-13H2,1H3,(H,29,30)/t18-,20-,21-,24-,25+,26+/m0/s1 |
| InChIKey | RJIMRSDEMWRLIM-NVMZHDJTSA-N |
| XLogP | 4.28 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.52 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|