C21H28O3S — CID 123293149
(8S,9S,10R,13S,14S,16R)-10,13,16-trimethyl-1,3-dioxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-17-carbothioic S-acid (PubChem CID 123293149) has the molecular formula C21H28O3S and a molecular weight of 360.52 g/mol. Its IUPAC name is (8S,9S,10R,13S,14S,16R)-10,13,16-trimethyl-1,3-dioxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-17-carbothioic S-acid.
| Compound Name | (8S,9S,10R,13S,14S,16R)-10,13,16-trimethyl-1,3-dioxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-17-carbothioic S-acid |
|---|---|
| PubChem CID | 123293149 |
| Molecular Formula | C21H28O3S |
| Molecular Weight | 360.52 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | (8S,9S,10R,13S,14S,16R)-10,13,16-trimethyl-1,3-dioxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-17-carbothioic S-acid |
| SMILES | C[C@@H]1C[C@H]2[C@@H]3CCC4=CC(=O)CC(=O)[C@]4(C)[C@H]3CC[C@]2(C)C1C(=O)S |
| InChI | InChI=1S/C21H28O3S/c1-11-8-16-14-5-4-12-9-13(22)10-17(23)21(12,3)15(14)6-7-20(16,2)18(11)19(24)25/h9,11,14-16,18H,4-8,10H2,1-3H3,(H,24,25)/t11-,14-,15+,16+,18?,20+,21+/m1/s1 |
| InChIKey | BMMIIVKCBLOCQF-JCWYQRACSA-N |
| XLogP | 4.02 |
| TPSA | 51.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.52 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|