C22H30O3 — CID 57198410
(8S,9S,10R,13R,14S,17S)-17-ethyl-7-hydroxy-10,13-dimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-1-carbaldehyde (PubChem CID 57198410) has the molecular formula C22H30O3 and a molecular weight of 342.48 g/mol. Its IUPAC name is (8S,9S,10R,13R,14S,17S)-17-ethyl-7-hydroxy-10,13-dimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-1-carbaldehyde.
| Compound Name | (8S,9S,10R,13R,14S,17S)-17-ethyl-7-hydroxy-10,13-dimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-1-carbaldehyde |
|---|---|
| PubChem CID | 57198410 |
| Molecular Formula | C22H30O3 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.22 |
| IUPAC Name | (8S,9S,10R,13R,14S,17S)-17-ethyl-7-hydroxy-10,13-dimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-1-carbaldehyde |
| SMILES | CC[C@H]1CC[C@H]2[C@@H]3C(O)CC4=CC(=O)C=C(C=O)[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C22H30O3/c1-4-13-5-6-17-20-18(7-8-21(13,17)2)22(3)14(11-19(20)25)9-16(24)10-15(22)12-23/h9-10,12-13,17-20,25H,4-8,11H2,1-3H3/t13-,17-,18-,19?,20-,21+,22+/m0/s1 |
| InChIKey | FFKNCDCEKVVUAH-DISCHBQUSA-N |
| XLogP | 3.86 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|