C21H32O3 — CID 86748218
(1S,2R,3R,5S,6R,10R,11S,12S,15S,16R)-15-ethyl-2,16-dimethyl-4-oxapentacyclo[9.7.0.02,8.03,5.012,16]octadec-7-ene-6,10-diol (PubChem CID 86748218) has the molecular formula C21H32O3 and a molecular weight of 332.48 g/mol. Its IUPAC name is (1S,2R,3R,5S,6R,10R,11S,12S,15S,16R)-15-ethyl-2,16-dimethyl-4-oxapentacyclo[9.7.0.02,8.03,5.012,16]octadec-7-ene-6,10-diol.
| Compound Name | (1S,2R,3R,5S,6R,10R,11S,12S,15S,16R)-15-ethyl-2,16-dimethyl-4-oxapentacyclo[9.7.0.02,8.03,5.012,16]octadec-7-ene-6,10-diol |
|---|---|
| PubChem CID | 86748218 |
| Molecular Formula | C21H32O3 |
| Molecular Weight | 332.48 g/mol |
| Exact Mass | 332.24 |
| IUPAC Name | (1S,2R,3R,5S,6R,10R,11S,12S,15S,16R)-15-ethyl-2,16-dimethyl-4-oxapentacyclo[9.7.0.02,8.03,5.012,16]octadec-7-ene-6,10-diol |
| SMILES | CC[C@H]1CC[C@H]2[C@@H]3[C@H](O)CC4=C[C@@H](O)[C@@H]5O[C@@H]5[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C21H32O3/c1-4-11-5-6-13-17-14(7-8-20(11,13)2)21(3)12(9-15(17)22)10-16(23)18-19(21)24-18/h10-11,13-19,22-23H,4-9H2,1-3H3/t11-,13-,14-,15+,16+,17-,18-,19-,20+,21-/m0/s1 |
| InChIKey | BJVZXGNFNKMSNM-YGCAKEOESA-N |
| XLogP | 3.29 |
| TPSA | 52.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.48 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|