C25H37NO5 — CID 57181020
[(1S,2R,11S,12S,15R,16S)-6-hydroxy-2,16-dimethyl-15-(1-oxopropan-2-yl)-4-oxapentacyclo[9.7.0.02,8.03,5.012,16]octadec-8-en-10-yl] N,N-dimethylcarbamate (PubChem CID 57181020) has the molecular formula C25H37NO5 and a molecular weight of 431.57 g/mol. Its IUPAC name is [(1S,2R,11S,12S,15R,16S)-6-hydroxy-2,16-dimethyl-15-(1-oxopropan-2-yl)-4-oxapentacyclo[9.7.0.02,8.03,5.012,16]octadec-8-en-10-yl] N,N-dimethylcarbamate.
| Compound Name | [(1S,2R,11S,12S,15R,16S)-6-hydroxy-2,16-dimethyl-15-(1-oxopropan-2-yl)-4-oxapentacyclo[9.7.0.02,8.03,5.012,16]octadec-8-en-10-yl] N,N-dimethylcarbamate |
|---|---|
| PubChem CID | 57181020 |
| Molecular Formula | C25H37NO5 |
| Molecular Weight | 431.57 g/mol |
| Exact Mass | 431.27 |
| IUPAC Name | [(1S,2R,11S,12S,15R,16S)-6-hydroxy-2,16-dimethyl-15-(1-oxopropan-2-yl)-4-oxapentacyclo[9.7.0.02,8.03,5.012,16]octadec-8-en-10-yl] N,N-dimethylcarbamate |
| SMILES | CC(C=O)[C@H]1CC[C@H]2[C@@H]3C(OC(=O)N(C)C)C=C4CC(O)C5OC5[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C25H37NO5/c1-13(12-27)15-6-7-16-20-17(8-9-24(15,16)2)25(3)14(10-18(28)21-22(25)31-21)11-19(20)30-23(29)26(4)5/h11-13,15-22,28H,6-10H2,1-5H3/t13?,15-,16+,17+,18?,19?,20+,21?,22?,24-,25+/m1/s1 |
| InChIKey | GRLNGCCZQBQZRY-RCDFHTEESA-N |
| XLogP | 3.43 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.57 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|