C21H32O2 — CID 70615630
(8S,9S,10R,13R,14S,17S)-17-ethyl-10,13-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydro-3H-cyclopenta[a]phenanthrene-6,7-diol (PubChem CID 70615630) has the molecular formula C21H32O2 and a molecular weight of 316.49 g/mol. Its IUPAC name is (8S,9S,10R,13R,14S,17S)-17-ethyl-10,13-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydro-3H-cyclopenta[a]phenanthrene-6,7-diol.
| Compound Name | (8S,9S,10R,13R,14S,17S)-17-ethyl-10,13-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydro-3H-cyclopenta[a]phenanthrene-6,7-diol |
|---|---|
| PubChem CID | 70615630 |
| Molecular Formula | C21H32O2 |
| Molecular Weight | 316.49 g/mol |
| Exact Mass | 316.24 |
| IUPAC Name | (8S,9S,10R,13R,14S,17S)-17-ethyl-10,13-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydro-3H-cyclopenta[a]phenanthrene-6,7-diol |
| SMILES | CC[C@H]1CC[C@H]2[C@@H]3C(O)C(O)C4=CCC=C[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C21H32O2/c1-4-13-8-9-14-17-15(10-12-20(13,14)2)21(3)11-6-5-7-16(21)18(22)19(17)23/h6-7,11,13-15,17-19,22-23H,4-5,8-10,12H2,1-3H3/t13-,14-,15-,17-,18?,19?,20+,21+/m0/s1 |
| InChIKey | VAYOEPJCGACDNE-WAQAYTOGSA-N |
| XLogP | 4.08 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.49 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|