C21H31F — CID 22790924
(8S,9R,10S,13R,14S,17S)-17-ethyl-9-fluoro-10,13-dimethyl-3,6,7,8,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene (PubChem CID 22790924) has the molecular formula C21H31F and a molecular weight of 302.48 g/mol. Its IUPAC name is (8S,9R,10S,13R,14S,17S)-17-ethyl-9-fluoro-10,13-dimethyl-3,6,7,8,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene.
| Compound Name | (8S,9R,10S,13R,14S,17S)-17-ethyl-9-fluoro-10,13-dimethyl-3,6,7,8,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 22790924 |
| Molecular Formula | C21H31F |
| Molecular Weight | 302.48 g/mol |
| Exact Mass | 302.24 |
| IUPAC Name | (8S,9R,10S,13R,14S,17S)-17-ethyl-9-fluoro-10,13-dimethyl-3,6,7,8,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene |
| SMILES | CC[C@H]1CC[C@H]2[C@@H]3CCC4=CCC=C[C@]4(C)[C@@]3(F)CC[C@]12C |
| InChI | InChI=1S/C21H31F/c1-4-15-8-10-17-18-11-9-16-7-5-6-12-20(16,3)21(18,22)14-13-19(15,17)2/h6-7,12,15,17-18H,4-5,8-11,13-14H2,1-3H3/t15-,17-,18-,19+,20-,21+/m0/s1 |
| InChIKey | DLLIQVVOUQBHGG-GGLFOPPFSA-N |
| XLogP | 6.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.48 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|