C22H32Cl2 — CID 22827687
(8S,9R,10S,11S,13R,14S,16R,17R)-9,11-dichloro-17-ethyl-10,13,16-trimethyl-3,6,7,8,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene (PubChem CID 22827687) has the molecular formula C22H32Cl2 and a molecular weight of 367.40 g/mol. Its IUPAC name is (8S,9R,10S,11S,13R,14S,16R,17R)-9,11-dichloro-17-ethyl-10,13,16-trimethyl-3,6,7,8,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene.
| Compound Name | (8S,9R,10S,11S,13R,14S,16R,17R)-9,11-dichloro-17-ethyl-10,13,16-trimethyl-3,6,7,8,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 22827687 |
| Molecular Formula | C22H32Cl2 |
| Molecular Weight | 367.40 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | (8S,9R,10S,11S,13R,14S,16R,17R)-9,11-dichloro-17-ethyl-10,13,16-trimethyl-3,6,7,8,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene |
| SMILES | CC[C@@H]1[C@H](C)C[C@H]2[C@@H]3CCC4=CCC=C[C@]4(C)[C@@]3(Cl)[C@@H](Cl)C[C@]12C |
| InChI | InChI=1S/C22H32Cl2/c1-5-16-14(2)12-18-17-10-9-15-8-6-7-11-21(15,4)22(17,24)19(23)13-20(16,18)3/h7-8,11,14,16-19H,5-6,9-10,12-13H2,1-4H3/t14-,16-,17+,18+,19+,20-,21+,22+/m1/s1 |
| InChIKey | GLNUYKSBRHENIX-TYRCQDGDSA-N |
| XLogP | 6.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.40 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|