C22H29ClO3 — CID 70518019
(8S,9R,10S,13S,14S,17S)-17-acetyl-9-chloro-11-hydroxy-10,13,16-trimethyl-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-3-one (PubChem CID 70518019) has the molecular formula C22H29ClO3 and a molecular weight of 376.92 g/mol. Its IUPAC name is (8S,9R,10S,13S,14S,17S)-17-acetyl-9-chloro-11-hydroxy-10,13,16-trimethyl-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,9R,10S,13S,14S,17S)-17-acetyl-9-chloro-11-hydroxy-10,13,16-trimethyl-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 70518019 |
| Molecular Formula | C22H29ClO3 |
| Molecular Weight | 376.92 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | (8S,9R,10S,13S,14S,17S)-17-acetyl-9-chloro-11-hydroxy-10,13,16-trimethyl-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-3-one |
| SMILES | CC(=O)[C@H]1C(C)C[C@H]2[C@@H]3CCC4=CC(=O)C=C[C@]4(C)[C@@]3(Cl)C(O)C[C@]12C |
| InChI | InChI=1S/C22H29ClO3/c1-12-9-17-16-6-5-14-10-15(25)7-8-21(14,4)22(16,23)18(26)11-20(17,3)19(12)13(2)24/h7-8,10,12,16-19,26H,5-6,9,11H2,1-4H3/t12?,16-,17-,18?,19+,20-,21-,22-/m0/s1 |
| InChIKey | CUAUDMVOCBXAEX-NYNHOBLRSA-N |
| XLogP | 4.08 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.92 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|