C22H28F2O3S — CID 87688694
S-(fluoromethyl) (9S,16R)-9-fluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthrene-17-carbothioate (PubChem CID 87688694) has the molecular formula C22H28F2O3S and a molecular weight of 410.53 g/mol. Its IUPAC name is S-(fluoromethyl) (9S,16R)-9-fluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthrene-17-carbothioate.
| Compound Name | S-(fluoromethyl) (9S,16R)-9-fluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthrene-17-carbothioate |
|---|---|
| PubChem CID | 87688694 |
| Molecular Formula | C22H28F2O3S |
| Molecular Weight | 410.53 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | S-(fluoromethyl) (9S,16R)-9-fluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthrene-17-carbothioate |
| SMILES | C[C@@H]1CC2C3CCC4=CC(=O)C=CC4(C)[C@]3(F)C(O)CC2(C)C1C(=O)SCF |
| InChI | InChI=1S/C22H28F2O3S/c1-12-8-16-15-5-4-13-9-14(25)6-7-21(13,3)22(15,24)17(26)10-20(16,2)18(12)19(27)28-11-23/h6-7,9,12,15-18,26H,4-5,8,10-11H2,1-3H3/t12-,15?,16?,17?,18?,20?,21?,22-/m1/s1 |
| InChIKey | QGUFLCFQHAMXBS-ZDYFPJODSA-N |
| XLogP | 4.41 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.53 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|