C25H34F3NO4S — CID 144898994
S-(fluoromethyl) (6S,9R,10S,11S,13S,14S,16R,17S)-6,9-difluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthrene-17-carbothioate;propanamide (PubChem CID 144898994) has the molecular formula C25H34F3NO4S and a molecular weight of 501.61 g/mol. Its IUPAC name is S-(fluoromethyl) (6S,9R,10S,11S,13S,14S,16R,17S)-6,9-difluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthrene-17-carbothioate;propanamide.
| Compound Name | S-(fluoromethyl) (6S,9R,10S,11S,13S,14S,16R,17S)-6,9-difluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthrene-17-carbothioate;propanamide |
|---|---|
| PubChem CID | 144898994 |
| Molecular Formula | C25H34F3NO4S |
| Molecular Weight | 501.61 g/mol |
| Exact Mass | 501.22 |
| IUPAC Name | S-(fluoromethyl) (6S,9R,10S,11S,13S,14S,16R,17S)-6,9-difluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthrene-17-carbothioate;propanamide |
| SMILES | CCC(N)=O.C[C@@H]1C[C@H]2C3C[C@H](F)C4=CC(=O)C=C[C@]4(C)[C@@]3(F)[C@@H](O)C[C@]2(C)[C@H]1C(=O)SCF |
| InChI | InChI=1S/C22H27F3O3S.C3H7NO/c1-11-6-13-14-8-16(24)15-7-12(26)4-5-21(15,3)22(14,25)17(27)9-20(13,2)18(11)19(28)29-10-23;1-2-3(4)5/h4-5,7,11,13-14,16-18,27H,6,8-10H2,1-3H3;2H2,1H3,(H2,4,5)/t11-,13+,14?,16+,17+,18-,20+,21+,22+;/m1./s1 |
| InChIKey | XYCRZRSHZTYONO-VUSCVWORSA-N |
| XLogP | 4.24 |
| TPSA | 97.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.61 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|