C22H30F2O4 — CID 143257796
(6S,9R,16R)-6,9-difluoro-11-hydroxy-10,13,16,17-tetramethyl-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-3-one;formic acid (PubChem CID 143257796) has the molecular formula C22H30F2O4 and a molecular weight of 396.47 g/mol. Its IUPAC name is (6S,9R,16R)-6,9-difluoro-11-hydroxy-10,13,16,17-tetramethyl-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-3-one;formic acid.
| Compound Name | (6S,9R,16R)-6,9-difluoro-11-hydroxy-10,13,16,17-tetramethyl-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-3-one;formic acid |
|---|---|
| PubChem CID | 143257796 |
| Molecular Formula | C22H30F2O4 |
| Molecular Weight | 396.47 g/mol |
| Exact Mass | 396.21 |
| IUPAC Name | (6S,9R,16R)-6,9-difluoro-11-hydroxy-10,13,16,17-tetramethyl-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-3-one;formic acid |
| SMILES | CC1[C@H](C)CC2C3C[C@H](F)C4=CC(=O)C=CC4(C)[C@@]3(F)C(O)CC21C.O=CO |
| InChI | InChI=1S/C21H28F2O2.CH2O2/c1-11-7-14-15-9-17(22)16-8-13(24)5-6-20(16,4)21(15,23)18(25)10-19(14,3)12(11)2;2-1-3/h5-6,8,11-12,14-15,17-18,25H,7,9-10H2,1-4H3;1H,(H,2,3)/t11-,12?,14?,15?,17+,18?,19?,20?,21+;/m1./s1 |
| InChIKey | QRXOOQDAOBTAAZ-JVZSDMEHSA-N |
| XLogP | 3.89 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.47 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|