C22H28F2O4 — CID 143220868
methyl (6S,9R,10S,13S,16R,17S)-6,9-difluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthrene-17-carboxylate (PubChem CID 143220868) has the molecular formula C22H28F2O4 and a molecular weight of 394.46 g/mol. Its IUPAC name is methyl (6S,9R,10S,13S,16R,17S)-6,9-difluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthrene-17-carboxylate.
| Compound Name | methyl (6S,9R,10S,13S,16R,17S)-6,9-difluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthrene-17-carboxylate |
|---|---|
| PubChem CID | 143220868 |
| Molecular Formula | C22H28F2O4 |
| Molecular Weight | 394.46 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | methyl (6S,9R,10S,13S,16R,17S)-6,9-difluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthrene-17-carboxylate |
| SMILES | COC(=O)[C@H]1[C@H](C)CC2C3C[C@H](F)C4=CC(=O)C=C[C@]4(C)[C@@]3(F)C(O)C[C@@]21C |
| InChI | InChI=1S/C22H28F2O4/c1-11-7-13-14-9-16(23)15-8-12(25)5-6-21(15,3)22(14,24)17(26)10-20(13,2)18(11)19(27)28-4/h5-6,8,11,13-14,16-18,26H,7,9-10H2,1-4H3/t11-,13?,14?,16+,17?,18-,20+,21+,22+/m1/s1 |
| InChIKey | CBAIGYVKAMGZRD-RTVIAGQWSA-N |
| XLogP | 3.34 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.46 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |