C27H38F2O4 — CID 70360360
(8S,9R,10S,13S,14S,17S)-6,9-difluoro-11-hydroxy-10,13,16-trimethyl-17-(2-pentoxyacetyl)-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-3-one (PubChem CID 70360360) has the molecular formula C27H38F2O4 and a molecular weight of 464.59 g/mol. Its IUPAC name is (8S,9R,10S,13S,14S,17S)-6,9-difluoro-11-hydroxy-10,13,16-trimethyl-17-(2-pentoxyacetyl)-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,9R,10S,13S,14S,17S)-6,9-difluoro-11-hydroxy-10,13,16-trimethyl-17-(2-pentoxyacetyl)-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 70360360 |
| Molecular Formula | C27H38F2O4 |
| Molecular Weight | 464.59 g/mol |
| Exact Mass | 464.27 |
| IUPAC Name | (8S,9R,10S,13S,14S,17S)-6,9-difluoro-11-hydroxy-10,13,16-trimethyl-17-(2-pentoxyacetyl)-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-3-one |
| SMILES | CCCCCOCC(=O)[C@H]1C(C)C[C@H]2[C@@H]3CC(F)C4=CC(=O)C=C[C@]4(C)[C@@]3(F)C(O)C[C@]12C |
| InChI | InChI=1S/C27H38F2O4/c1-5-6-7-10-33-15-22(31)24-16(2)11-18-19-13-21(28)20-12-17(30)8-9-26(20,4)27(19,29)23(32)14-25(18,24)3/h8-9,12,16,18-19,21,23-24,32H,5-7,10-11,13-15H2,1-4H3/t16?,18-,19-,21?,23?,24+,25-,26-,27-/m0/s1 |
| InChIKey | KFWJRUXYLNGXNQ-GBGIKYIWSA-N |
| XLogP | 4.94 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.59 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|