C20H24F2O2 — CID 143213231
(10R,17S)-10,17-difluoro-9-hydroxy-4,11-dimethylpentacyclo[8.8.0.02,7.05,7.011,16]octadeca-12,15-dien-14-one (PubChem CID 143213231) has the molecular formula C20H24F2O2 and a molecular weight of 334.41 g/mol. Its IUPAC name is (10R,17S)-10,17-difluoro-9-hydroxy-4,11-dimethylpentacyclo[8.8.0.02,7.05,7.011,16]octadeca-12,15-dien-14-one.
| Compound Name | (10R,17S)-10,17-difluoro-9-hydroxy-4,11-dimethylpentacyclo[8.8.0.02,7.05,7.011,16]octadeca-12,15-dien-14-one |
|---|---|
| PubChem CID | 143213231 |
| Molecular Formula | C20H24F2O2 |
| Molecular Weight | 334.41 g/mol |
| Exact Mass | 334.17 |
| IUPAC Name | (10R,17S)-10,17-difluoro-9-hydroxy-4,11-dimethylpentacyclo[8.8.0.02,7.05,7.011,16]octadeca-12,15-dien-14-one |
| SMILES | CC1CC2C3C[C@H](F)C4=CC(=O)C=CC4(C)[C@@]3(F)C(O)CC23CC13 |
| InChI | InChI=1S/C20H24F2O2/c1-10-5-12-13-7-16(21)14-6-11(23)3-4-18(14,2)20(13,22)17(24)9-19(12)8-15(10)19/h3-4,6,10,12-13,15-17,24H,5,7-9H2,1-2H3/t10?,12?,13?,15?,16-,17?,18?,19?,20-/m0/s1 |
| InChIKey | UREYVIFMTKPFII-WIXGHOPKSA-N |
| XLogP | 3.55 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.41 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |