C22H26F2O4 — CID 22793222
(6S,8S,9R,10S,11R,13S,14S,17R)-17-acetyl-6,9-difluoro-11,17-dihydroxy-10,13-dimethyl-16-methylidene-7,8,11,12,14,15-hexahydro-6H-cyclopenta[a]phenanthren-3-one (PubChem CID 22793222) has the molecular formula C22H26F2O4 and a molecular weight of 392.44 g/mol. Its IUPAC name is (6S,8S,9R,10S,11R,13S,14S,17R)-17-acetyl-6,9-difluoro-11,17-dihydroxy-10,13-dimethyl-16-methylidene-7,8,11,12,14,15-hexahydro-6H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (6S,8S,9R,10S,11R,13S,14S,17R)-17-acetyl-6,9-difluoro-11,17-dihydroxy-10,13-dimethyl-16-methylidene-7,8,11,12,14,15-hexahydro-6H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 22793222 |
| Molecular Formula | C22H26F2O4 |
| Molecular Weight | 392.44 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | (6S,8S,9R,10S,11R,13S,14S,17R)-17-acetyl-6,9-difluoro-11,17-dihydroxy-10,13-dimethyl-16-methylidene-7,8,11,12,14,15-hexahydro-6H-cyclopenta[a]phenanthren-3-one |
| SMILES | C=C1C[C@H]2[C@@H]3C[C@H](F)C4=CC(=O)C=C[C@]4(C)[C@@]3(F)[C@H](O)C[C@]2(C)[C@@]1(O)C(C)=O |
| InChI | InChI=1S/C22H26F2O4/c1-11-7-14-15-9-17(23)16-8-13(26)5-6-19(16,3)21(15,24)18(27)10-20(14,4)22(11,28)12(2)25/h5-6,8,14-15,17-18,27-28H,1,7,9-10H2,2-4H3/t14-,15-,17-,18+,19-,20-,21-,22-/m0/s1 |
| InChIKey | RQNNVMHAIGULMG-LVXIIMQZSA-N |
| XLogP | 2.79 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.44 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|