C19H24F2O2 — CID 67710657
(6S,8S,9R,10S,11S,13S,14S)-6,9-difluoro-11-hydroxy-10,13-dimethyl-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-3-one (PubChem CID 67710657) has the molecular formula C19H24F2O2 and a molecular weight of 322.39 g/mol. Its IUPAC name is (6S,8S,9R,10S,11S,13S,14S)-6,9-difluoro-11-hydroxy-10,13-dimethyl-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (6S,8S,9R,10S,11S,13S,14S)-6,9-difluoro-11-hydroxy-10,13-dimethyl-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 67710657 |
| Molecular Formula | C19H24F2O2 |
| Molecular Weight | 322.39 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | (6S,8S,9R,10S,11S,13S,14S)-6,9-difluoro-11-hydroxy-10,13-dimethyl-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-3-one |
| SMILES | C[C@@]12CCC[C@H]1[C@@H]1C[C@H](F)C3=CC(=O)C=C[C@]3(C)[C@@]1(F)[C@@H](O)C2 |
| InChI | InChI=1S/C19H24F2O2/c1-17-6-3-4-12(17)13-9-15(20)14-8-11(22)5-7-18(14,2)19(13,21)16(23)10-17/h5,7-8,12-13,15-16,23H,3-4,6,9-10H2,1-2H3/t12-,13-,15-,16-,17-,18-,19-/m0/s1 |
| InChIKey | DHCCDJGCQFAKPF-OJYUIOMHSA-N |
| XLogP | 3.70 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.39 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |