C21H24F2O3S — CID 142271916
(6S,9R,10S,11S,13S)-6,9-difluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-7,8,11,12,14,15-hexahydro-6H-cyclopenta[a]phenanthrene-17-carbothioic S-acid (PubChem CID 142271916) has the molecular formula C21H24F2O3S and a molecular weight of 394.48 g/mol. Its IUPAC name is (6S,9R,10S,11S,13S)-6,9-difluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-7,8,11,12,14,15-hexahydro-6H-cyclopenta[a]phenanthrene-17-carbothioic S-acid.
| Compound Name | (6S,9R,10S,11S,13S)-6,9-difluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-7,8,11,12,14,15-hexahydro-6H-cyclopenta[a]phenanthrene-17-carbothioic S-acid |
|---|---|
| PubChem CID | 142271916 |
| Molecular Formula | C21H24F2O3S |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | (6S,9R,10S,11S,13S)-6,9-difluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-7,8,11,12,14,15-hexahydro-6H-cyclopenta[a]phenanthrene-17-carbothioic S-acid |
| SMILES | CC1=C(C(=O)S)[C@@]2(C)C[C@H](O)[C@@]3(F)C(C[C@H](F)C4=CC(=O)C=C[C@@]43C)C2C1 |
| InChI | InChI=1S/C21H24F2O3S/c1-10-6-12-13-8-15(22)14-7-11(24)4-5-20(14,3)21(13,23)16(25)9-19(12,2)17(10)18(26)27/h4-5,7,12-13,15-16,25H,6,8-9H2,1-3H3,(H,26,27)/t12?,13?,15-,16-,19-,20-,21-/m0/s1 |
| InChIKey | FLTVIMRTWDNNOP-ZVCPEKEGSA-N |
| XLogP | 3.69 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|