C26H32F2O5S — CID 87594917
(6S,8S,9R,10S,11S,13S,14S,16R,17R)-17-(cyclobutanecarbonyloxy)-6,9-difluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17-carbothioic S-acid (PubChem CID 87594917) has the molecular formula C26H32F2O5S and a molecular weight of 494.60 g/mol. Its IUPAC name is (6S,8S,9R,10S,11S,13S,14S,16R,17R)-17-(cyclobutanecarbonyloxy)-6,9-difluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17-carbothioic S-acid.
| Compound Name | (6S,8S,9R,10S,11S,13S,14S,16R,17R)-17-(cyclobutanecarbonyloxy)-6,9-difluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17-carbothioic S-acid |
|---|---|
| PubChem CID | 87594917 |
| Molecular Formula | C26H32F2O5S |
| Molecular Weight | 494.60 g/mol |
| Exact Mass | 494.19 |
| IUPAC Name | (6S,8S,9R,10S,11S,13S,14S,16R,17R)-17-(cyclobutanecarbonyloxy)-6,9-difluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17-carbothioic S-acid |
| SMILES | C[C@@H]1C[C@H]2[C@@H]3C[C@H](F)C4=CC(=O)C=C[C@]4(C)[C@@]3(F)[C@@H](O)C[C@]2(C)[C@@]1(OC(=O)C1CCC1)C(=O)S |
| InChI | InChI=1S/C26H32F2O5S/c1-13-9-16-17-11-19(27)18-10-15(29)7-8-23(18,2)25(17,28)20(30)12-24(16,3)26(13,22(32)34)33-21(31)14-5-4-6-14/h7-8,10,13-14,16-17,19-20,30H,4-6,9,11-12H2,1-3H3,(H,32,34)/t13-,16+,17+,19+,20+,23+,24+,25+,26+/m1/s1 |
| InChIKey | XZSNDGSMZICSNM-RBYLSPKKSA-N |
| XLogP | 4.09 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.60 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|