C28H36F2O5S — CID 90914038
(8S,10S,13S,14S)-6,9-difluoro-11-hydroxy-10,13,16-trimethyl-17-(1-methylcyclopentanecarbonyl)oxy-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17-carbothioic S-acid (PubChem CID 90914038) has the molecular formula C28H36F2O5S and a molecular weight of 522.65 g/mol. Its IUPAC name is (8S,10S,13S,14S)-6,9-difluoro-11-hydroxy-10,13,16-trimethyl-17-(1-methylcyclopentanecarbonyl)oxy-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17-carbothioic S-acid.
| Compound Name | (8S,10S,13S,14S)-6,9-difluoro-11-hydroxy-10,13,16-trimethyl-17-(1-methylcyclopentanecarbonyl)oxy-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17-carbothioic S-acid |
|---|---|
| PubChem CID | 90914038 |
| Molecular Formula | C28H36F2O5S |
| Molecular Weight | 522.65 g/mol |
| Exact Mass | 522.23 |
| IUPAC Name | (8S,10S,13S,14S)-6,9-difluoro-11-hydroxy-10,13,16-trimethyl-17-(1-methylcyclopentanecarbonyl)oxy-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17-carbothioic S-acid |
| SMILES | CC1C[C@H]2[C@@H]3CC(F)C4=CC(=O)C=C[C@]4(C)C3(F)C(O)C[C@]2(C)C1(OC(=O)C1(C)CCCC1)C(=O)S |
| InChI | InChI=1S/C28H36F2O5S/c1-15-11-17-18-13-20(29)19-12-16(31)7-10-25(19,3)27(18,30)21(32)14-26(17,4)28(15,23(34)36)35-22(33)24(2)8-5-6-9-24/h7,10,12,15,17-18,20-21,32H,5-6,8-9,11,13-14H2,1-4H3,(H,34,36)/t15?,17-,18-,20?,21?,25-,26-,27?,28?/m0/s1 |
| InChIKey | IFGVFJVIYBSLGT-CJIHEZBCSA-N |
| XLogP | 4.87 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.65 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|