C26H27BrF2O6S — CID 91241891
(8S,10S,13S,14S)-17-(5-bromofuran-2-carbonyl)oxy-6,9-difluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17-carbothioic S-acid (PubChem CID 91241891) has the molecular formula C26H27BrF2O6S and a molecular weight of 585.46 g/mol. Its IUPAC name is (8S,10S,13S,14S)-17-(5-bromofuran-2-carbonyl)oxy-6,9-difluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17-carbothioic S-acid.
| Compound Name | (8S,10S,13S,14S)-17-(5-bromofuran-2-carbonyl)oxy-6,9-difluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17-carbothioic S-acid |
|---|---|
| PubChem CID | 91241891 |
| Molecular Formula | C26H27BrF2O6S |
| Molecular Weight | 585.46 g/mol |
| Exact Mass | 584.07 |
| IUPAC Name | (8S,10S,13S,14S)-17-(5-bromofuran-2-carbonyl)oxy-6,9-difluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17-carbothioic S-acid |
| SMILES | CC1C[C@H]2[C@@H]3CC(F)C4=CC(=O)C=C[C@]4(C)C3(F)C(O)C[C@]2(C)C1(OC(=O)c1ccc(Br)o1)C(=O)S |
| InChI | InChI=1S/C26H27BrF2O6S/c1-12-8-14-15-10-17(28)16-9-13(30)6-7-23(16,2)25(15,29)19(31)11-24(14,3)26(12,22(33)36)35-21(32)18-4-5-20(27)34-18/h4-7,9,12,14-15,17,19,31H,8,10-11H2,1-3H3,(H,33,36)/t12?,14-,15-,17?,19?,23-,24-,25?,26?/m0/s1 |
| InChIKey | KUGXUBNKSRDRTG-GDIKJXRFSA-N |
| XLogP | 4.96 |
| TPSA | 93.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.46 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|