C27H30F2O6S — CID 90812489
(8S,10S,13S,14S)-6,9-difluoro-11-hydroxy-10,13,16-trimethyl-17-(3-methylfuran-2-carbonyl)oxy-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17-carbothioic S-acid (PubChem CID 90812489) has the molecular formula C27H30F2O6S and a molecular weight of 520.59 g/mol. Its IUPAC name is (8S,10S,13S,14S)-6,9-difluoro-11-hydroxy-10,13,16-trimethyl-17-(3-methylfuran-2-carbonyl)oxy-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17-carbothioic S-acid.
| Compound Name | (8S,10S,13S,14S)-6,9-difluoro-11-hydroxy-10,13,16-trimethyl-17-(3-methylfuran-2-carbonyl)oxy-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17-carbothioic S-acid |
|---|---|
| PubChem CID | 90812489 |
| Molecular Formula | C27H30F2O6S |
| Molecular Weight | 520.59 g/mol |
| Exact Mass | 520.17 |
| IUPAC Name | (8S,10S,13S,14S)-6,9-difluoro-11-hydroxy-10,13,16-trimethyl-17-(3-methylfuran-2-carbonyl)oxy-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17-carbothioic S-acid |
| SMILES | Cc1ccoc1C(=O)OC1(C(=O)S)C(C)C[C@H]2[C@@H]3CC(F)C4=CC(=O)C=C[C@]4(C)C3(F)C(O)C[C@@]21C |
| InChI | InChI=1S/C27H30F2O6S/c1-13-6-8-34-21(13)22(32)35-27(23(33)36)14(2)9-16-17-11-19(28)18-10-15(30)5-7-24(18,3)26(17,29)20(31)12-25(16,27)4/h5-8,10,14,16-17,19-20,31H,9,11-12H2,1-4H3,(H,33,36)/t14?,16-,17-,19?,20?,24-,25-,26?,27?/m0/s1 |
| InChIKey | AYFMUMWLEZOPCF-CYFBUVJHSA-N |
| XLogP | 4.50 |
| TPSA | 93.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.59 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|