C21H25ClF2O3 — CID 123413157
17-(2-chloroacetyl)-6,9-difluoro-11-hydroxy-10,13-dimethyl-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-3-one (PubChem CID 123413157) has the molecular formula C21H25ClF2O3 and a molecular weight of 398.88 g/mol. Its IUPAC name is 17-(2-chloroacetyl)-6,9-difluoro-11-hydroxy-10,13-dimethyl-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-3-one.
| Compound Name | 17-(2-chloroacetyl)-6,9-difluoro-11-hydroxy-10,13-dimethyl-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 123413157 |
| Molecular Formula | C21H25ClF2O3 |
| Molecular Weight | 398.88 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | 17-(2-chloroacetyl)-6,9-difluoro-11-hydroxy-10,13-dimethyl-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-3-one |
| SMILES | CC12CC(O)C3(F)C(CC(F)C4=CC(=O)C=CC43C)C1CCC2C(=O)CCl |
| InChI | InChI=1S/C21H25ClF2O3/c1-19-9-18(27)21(24)14(12(19)3-4-13(19)17(26)10-22)8-16(23)15-7-11(25)5-6-20(15,21)2/h5-7,12-14,16,18,27H,3-4,8-10H2,1-2H3 |
| InChIKey | ZJLCMUVUAOBEKM-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.88 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|