C24H31F3O3S — CID 153400166
S-(fluoromethyl) (1R,9S,15R)-1,9-difluoro-19-hydroxy-2,15,17-trimethyl-5-oxotetracyclo[9.8.0.02,7.012,17]nonadeca-3,6-diene-16-carbothioate (PubChem CID 153400166) has the molecular formula C24H31F3O3S and a molecular weight of 456.57 g/mol. Its IUPAC name is S-(fluoromethyl) (1R,9S,15R)-1,9-difluoro-19-hydroxy-2,15,17-trimethyl-5-oxotetracyclo[9.8.0.02,7.012,17]nonadeca-3,6-diene-16-carbothioate.
| Compound Name | S-(fluoromethyl) (1R,9S,15R)-1,9-difluoro-19-hydroxy-2,15,17-trimethyl-5-oxotetracyclo[9.8.0.02,7.012,17]nonadeca-3,6-diene-16-carbothioate |
|---|---|
| PubChem CID | 153400166 |
| Molecular Formula | C24H31F3O3S |
| Molecular Weight | 456.57 g/mol |
| Exact Mass | 456.19 |
| IUPAC Name | S-(fluoromethyl) (1R,9S,15R)-1,9-difluoro-19-hydroxy-2,15,17-trimethyl-5-oxotetracyclo[9.8.0.02,7.012,17]nonadeca-3,6-diene-16-carbothioate |
| SMILES | C[C@@H]1CCC2C3C[C@H](F)CC4=CC(=O)C=CC4(C)[C@@]3(F)C(O)CC2(C)C1C(=O)SCF |
| InChI | InChI=1S/C24H31F3O3S/c1-13-4-5-17-18-10-15(26)8-14-9-16(28)6-7-23(14,3)24(18,27)19(29)11-22(17,2)20(13)21(30)31-12-25/h6-7,9,13,15,17-20,29H,4-5,8,10-12H2,1-3H3/t13-,15-,17?,18?,19?,20?,22?,23?,24+/m1/s1 |
| InChIKey | GVEZMWZRCIESAM-KRRDYFASSA-N |
| XLogP | 5.13 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.57 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|