C22H31ClO2 — CID 141384200
(1R,2S,10S,11S,13S,14R,15S)-14-(2-chloroethyl)-2,13,15-trimethyl-18-oxapentacyclo[8.8.0.01,17.02,7.011,15]octadeca-3,6-dien-14-ol (PubChem CID 141384200) has the molecular formula C22H31ClO2 and a molecular weight of 362.94 g/mol. Its IUPAC name is (1R,2S,10S,11S,13S,14R,15S)-14-(2-chloroethyl)-2,13,15-trimethyl-18-oxapentacyclo[8.8.0.01,17.02,7.011,15]octadeca-3,6-dien-14-ol.
| Compound Name | (1R,2S,10S,11S,13S,14R,15S)-14-(2-chloroethyl)-2,13,15-trimethyl-18-oxapentacyclo[8.8.0.01,17.02,7.011,15]octadeca-3,6-dien-14-ol |
|---|---|
| PubChem CID | 141384200 |
| Molecular Formula | C22H31ClO2 |
| Molecular Weight | 362.94 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | (1R,2S,10S,11S,13S,14R,15S)-14-(2-chloroethyl)-2,13,15-trimethyl-18-oxapentacyclo[8.8.0.01,17.02,7.011,15]octadeca-3,6-dien-14-ol |
| SMILES | C[C@H]1C[C@H]2[C@@H]3CCC4=CCC=C[C@]4(C)[C@]34OC4C[C@]2(C)[C@@]1(O)CCCl |
| InChI | InChI=1S/C22H31ClO2/c1-14-12-17-16-8-7-15-6-4-5-9-19(15,2)22(16)18(25-22)13-20(17,3)21(14,24)10-11-23/h5-6,9,14,16-18,24H,4,7-8,10-13H2,1-3H3/t14-,16-,17-,18?,19-,20-,21+,22-/m0/s1 |
| InChIKey | FJHRQUMEGHMIOB-GHHFXSOLSA-N |
| XLogP | 4.85 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.94 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|