C26H39ClO5 — CID 91523403
CID 91523403 (PubChem CID 91523403) has the molecular formula C26H39ClO5 and a molecular weight of 467.05 g/mol.
| Compound Name | CID 91523403 |
|---|---|
| PubChem CID | 91523403 |
| Molecular Formula | C26H39ClO5 |
| Molecular Weight | 467.05 g/mol |
| Exact Mass | 466.25 |
| IUPAC Name | — |
| SMILES | CC.C[C@@H]1C[C@H]2[C@@H]3CCC4=CCC=C[C@]4(C)[C@@]3(Cl)[C@@H](O)C[C@]2(C)[C@]12OCOC21COCO1 |
| InChI | InChI=1S/C24H33ClO5.C2H6/c1-15-10-18-17-8-7-16-6-4-5-9-20(16,2)23(17,25)19(26)11-21(18,3)24(15)22(29-14-30-24)12-27-13-28-22;1-2/h5-6,9,15,17-19,26H,4,7-8,10-14H2,1-3H3;1-2H3/t15-,17+,18+,19+,20+,21+,22?,23+,24-;/m1./s1 |
| InChIKey | HXRYRWVCIMKTMK-CXZMJDMSSA-N |
| XLogP | 5.16 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.05 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|