C25H37FO5 — CID 90890900
CID 90890900 (PubChem CID 90890900) has the molecular formula C25H37FO5 and a molecular weight of 436.56 g/mol.
| Compound Name | CID 90890900 |
|---|---|
| PubChem CID | 90890900 |
| Molecular Formula | C25H37FO5 |
| Molecular Weight | 436.56 g/mol |
| Exact Mass | 436.26 |
| IUPAC Name | — |
| SMILES | CC.C[C@@H]1C[C@@H]2C(C[C@H](O)[C@@]3(F)[C@H]2CCC2=CCC=C[C@@]23C)[C@]12OCOC21COCO1 |
| InChI | InChI=1S/C23H31FO5.C2H6/c1-14-9-16-17-7-6-15-5-3-4-8-20(15,2)22(17,24)19(25)10-18(16)23(14)21(28-13-29-23)11-26-12-27-21;1-2/h4-5,8,14,16-19,25H,3,6-7,9-13H2,1-2H3;1-2H3/t14-,16+,17+,18?,19+,20+,21?,22+,23-;/m1./s1 |
| InChIKey | MYEVRCHQQRFVBJ-URXWSRPDSA-N |
| XLogP | 4.50 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.56 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|