C24H31FO5 — CID 143581482
2-[(1S,4R,8S,9S,11S,12R,13S)-12-fluoro-11-hydroxy-6,6,9,13-tetramethyl-5,7-dioxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-dien-8-yl]-2-oxoacetaldehyde (PubChem CID 143581482) has the molecular formula C24H31FO5 and a molecular weight of 418.51 g/mol. Its IUPAC name is 2-[(1S,4R,8S,9S,11S,12R,13S)-12-fluoro-11-hydroxy-6,6,9,13-tetramethyl-5,7-dioxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-dien-8-yl]-2-oxoacetaldehyde.
| Compound Name | 2-[(1S,4R,8S,9S,11S,12R,13S)-12-fluoro-11-hydroxy-6,6,9,13-tetramethyl-5,7-dioxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-dien-8-yl]-2-oxoacetaldehyde |
|---|---|
| PubChem CID | 143581482 |
| Molecular Formula | C24H31FO5 |
| Molecular Weight | 418.51 g/mol |
| Exact Mass | 418.22 |
| IUPAC Name | 2-[(1S,4R,8S,9S,11S,12R,13S)-12-fluoro-11-hydroxy-6,6,9,13-tetramethyl-5,7-dioxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-dien-8-yl]-2-oxoacetaldehyde |
| SMILES | CC1(C)O[C@@H]2CC3[C@@H]4CCC5=CCC=C[C@]5(C)[C@@]4(F)[C@@H](O)C[C@]3(C)[C@]2(C(=O)C=O)O1 |
| InChI | InChI=1S/C24H31FO5/c1-20(2)29-19-11-16-15-9-8-14-7-5-6-10-21(14,3)23(15,25)17(27)12-22(16,4)24(19,30-20)18(28)13-26/h6-7,10,13,15-17,19,27H,5,8-9,11-12H2,1-4H3/t15-,16?,17-,19+,21-,22-,23-,24+/m0/s1 |
| InChIKey | NAASFNRKGIFLDV-CIZNKRRESA-N |
| XLogP | 3.45 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.51 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|